About N,N-dimethylhydroxylamine;N-methylmethanamine
N,N-dimethylhydroxylamine;N-methylmethanamine (PubChem CID 162079518) has the molecular formula C4H14N2O
and a molecular weight of 106.17 g/mol. Its IUPAC name is N,N-dimethylhydroxylamine;N-methylmethanamine.
Molecular Properties
| Compound Name | N,N-dimethylhydroxylamine;N-methylmethanamine |
| PubChem CID | 162079518 |
| Molecular Formula | C4H14N2O |
| Molecular Weight | 106.17 g/mol |
| Exact Mass | 106.11 |
| IUPAC Name | N,N-dimethylhydroxylamine;N-methylmethanamine |
| SMILES | CN(C)O.CNC |
| InChI | InChI=1S/C2H7NO.C2H7N/c1-3(2)4;1-3-2/h4H,1-2H3;3H,1-2H3 |
| InChIKey | ZCDOMHVOLZNHNW-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.17 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylhydroxylamine;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylhydroxylamine;N-methylmethanamine?
The IUPAC name of N,N-dimethylhydroxylamine;N-methylmethanamine (CID 162079518) is N,N-dimethylhydroxylamine;N-methylmethanamine.
What is the SMILES notation for N,N-dimethylhydroxylamine;N-methylmethanamine?
The canonical SMILES for N,N-dimethylhydroxylamine;N-methylmethanamine is CN(C)O.CNC.
What is the InChIKey of N,N-dimethylhydroxylamine;N-methylmethanamine?
The InChIKey is ZCDOMHVOLZNHNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NO.C2H7N/c1-3(2)4;1-3-2/h4H,1-2H3;3H,1-2H3.
What are the key properties of N,N-dimethylhydroxylamine;N-methylmethanamine?
N,N-dimethylhydroxylamine;N-methylmethanamine has a molecular weight of 106.17 g/mol, XLogP of -0.23, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylhydroxylamine;N-methylmethanamine is sourced from PubChem (CID 162079518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).