About 2,3,4,5-tetramethylthiophene
2,3,4,5-tetramethylthiophene (PubChem CID 162080525) has the molecular formula C16H24S2
and a molecular weight of 280.50 g/mol. Its IUPAC name is 2,3,4,5-tetramethylthiophene.
Molecular Properties
| Compound Name | 2,3,4,5-tetramethylthiophene |
| PubChem CID | 162080525 |
| Molecular Formula | C16H24S2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2,3,4,5-tetramethylthiophene |
| SMILES | Cc1sc(C)c(C)c1C.Cc1sc(C)c(C)c1C |
| InChI | InChI=1S/2C8H12S/c2*1-5-6(2)8(4)9-7(5)3/h2*1-4H3 |
| InChIKey | ZCGYIEPUUCAOBS-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3,4,5-tetramethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetramethylthiophene?
The IUPAC name of 2,3,4,5-tetramethylthiophene (CID 162080525) is 2,3,4,5-tetramethylthiophene.
What is the SMILES notation for 2,3,4,5-tetramethylthiophene?
The canonical SMILES for 2,3,4,5-tetramethylthiophene is Cc1sc(C)c(C)c1C.Cc1sc(C)c(C)c1C.
What is the InChIKey of 2,3,4,5-tetramethylthiophene?
The InChIKey is ZCGYIEPUUCAOBS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H12S/c2*1-5-6(2)8(4)9-7(5)3/h2*1-4H3.
What are the key properties of 2,3,4,5-tetramethylthiophene?
2,3,4,5-tetramethylthiophene has a molecular weight of 280.50 g/mol, XLogP of 5.96, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetramethylthiophene is sourced from PubChem (CID 162080525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).