C12H22ClN5O3S — CID 162082598
N-[1-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]-1-(propan-2-ylamino)propan-2-ylidene]hydroxylamine;hydrochloride (PubChem CID 162082598) has the molecular formula C12H22ClN5O3S and a molecular weight of 351.86 g/mol. Its IUPAC name is N-[1-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]-1-(propan-2-ylamino)propan-2-ylidene]hydroxylamine;hydrochloride.
| Compound Name | N-[1-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]-1-(propan-2-ylamino)propan-2-ylidene]hydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 162082598 |
| Molecular Formula | C12H22ClN5O3S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-[1-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]-1-(propan-2-ylamino)propan-2-ylidene]hydroxylamine;hydrochloride |
| SMILES | CC(=NO)C(NC(C)C)Oc1nsnc1N1CCOCC1.Cl |
| InChI | InChI=1S/C12H21N5O3S.ClH/c1-8(2)13-11(9(3)14-18)20-12-10(15-21-16-12)17-4-6-19-7-5-17;/h8,11,13,18H,4-7H2,1-3H3;1H |
| InChIKey | WCVOZLNTUCLBMS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|