C13H13BF6N2O5 — CID 162084085
[7-(aminomethoxy)-1-hydroxy-3H-2,1-benzoxaborol-3-yl]methanamine;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 162084085) has the molecular formula C13H13BF6N2O5 and a molecular weight of 402.06 g/mol. Its IUPAC name is [7-(aminomethoxy)-1-hydroxy-3H-2,1-benzoxaborol-3-yl]methanamine;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | [7-(aminomethoxy)-1-hydroxy-3H-2,1-benzoxaborol-3-yl]methanamine;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 162084085 |
| Molecular Formula | C13H13BF6N2O5 |
| Molecular Weight | 402.06 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | [7-(aminomethoxy)-1-hydroxy-3H-2,1-benzoxaborol-3-yl]methanamine;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | NCOc1cccc2c1B(O)OC2CN.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H13BN2O3.C4F6O2/c11-4-8-6-2-1-3-7(14-5-12)9(6)10(13)15-8;5-3(6,7)1(11)2(12)4(8,9)10/h1-3,8,13H,4-5,11-12H2; |
| InChIKey | ZCSOOKLWWURZDQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.06 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|