About 2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen
2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen (PubChem CID 162084757) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is 2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen.
Molecular Properties
| Compound Name | 2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen |
| PubChem CID | 162084757 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen |
| SMILES | Cc1cc(=O)n(C)[nH]1.[H][H] |
| InChI | InChI=1S/C5H8N2O.H2/c1-4-3-5(8)7(2)6-4;/h3,6H,1-2H3;1H |
| InChIKey | ZCUUOCIFWORMJJ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen?
The IUPAC name of 2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen (CID 162084757) is 2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen.
What is the SMILES notation for 2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen?
The canonical SMILES for 2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen is Cc1cc(=O)n(C)[nH]1.[H][H].
What is the InChIKey of 2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen?
The InChIKey is ZCUUOCIFWORMJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O.H2/c1-4-3-5(8)7(2)6-4;/h3,6H,1-2H3;1H.
What are the key properties of 2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen?
2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen has a molecular weight of 114.15 g/mol, XLogP of 0.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1H-pyrazol-3-one;molecular hydrogen is sourced from PubChem (CID 162084757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).