C25H21N3O2 — CID 162085685
3,6-dimethyl-[1]benzofuro[2,3-b]pyridine;4,12-dimethyl-8-oxa-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 162085685) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3,6-dimethyl-[1]benzofuro[2,3-b]pyridine;4,12-dimethyl-8-oxa-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 3,6-dimethyl-[1]benzofuro[2,3-b]pyridine;4,12-dimethyl-8-oxa-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 162085685 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3,6-dimethyl-[1]benzofuro[2,3-b]pyridine;4,12-dimethyl-8-oxa-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1ccc2oc3ncc(C)cc3c2c1.Cc1cnc2oc3ncc(C)cc3c2c1 |
| InChI | InChI=1S/C13H11NO.C12H10N2O/c1-8-3-4-12-10(5-8)11-6-9(2)7-14-13(11)15-12;1-7-3-9-10-4-8(2)6-14-12(10)15-11(9)13-5-7/h3-7H,1-2H3;3-6H,1-2H3 |
| InChIKey | ZCXSWZPXYXMKDR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |