C33H33ClF3N3O6S — CID 162088894
7-(dimethylamino)-4-(trifluoromethyl)chromen-2-one;4-[4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]-N,N-dimethylaniline;perchlorate (PubChem CID 162088894) has the molecular formula C33H33ClF3N3O6S and a molecular weight of 692.16 g/mol. Its IUPAC name is 7-(dimethylamino)-4-(trifluoromethyl)chromen-2-one;4-[4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]-N,N-dimethylaniline;perchlorate.
| Compound Name | 7-(dimethylamino)-4-(trifluoromethyl)chromen-2-one;4-[4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]-N,N-dimethylaniline;perchlorate |
|---|---|
| PubChem CID | 162088894 |
| Molecular Formula | C33H33ClF3N3O6S |
| Molecular Weight | 692.16 g/mol |
| Exact Mass | 691.17 |
| IUPAC Name | 7-(dimethylamino)-4-(trifluoromethyl)chromen-2-one;4-[4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)buta-1,3-dienyl]-N,N-dimethylaniline;perchlorate |
| SMILES | CC[n+]1c(C=CC=Cc2ccc(N(C)C)cc2)sc2ccccc21.CN(C)c1ccc2c(C(F)(F)F)cc(=O)oc2c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H23N2S.C12H10F3NO2.ClHO4/c1-4-23-19-10-6-7-11-20(19)24-21(23)12-8-5-9-17-13-15-18(16-14-17)22(2)3;1-16(2)7-3-4-8-9(12(13,14)15)6-11(17)18-10(8)5-7;2-1(3,4)5/h5-16H,4H2,1-3H3;3-6H,1-2H3;(H,2,3,4,5)/q+1;;/p-1 |
| InChIKey | ZDIHMTVIRMMAKJ-UHFFFAOYSA-M |
| XLogP | 3.12 |
| TPSA | 132.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.16 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|