C26H25N5O5 — CID 162090161
4-(4-aminophenoxy)-N-methylpyridine-2-carboxamide;methyl 4-(4-aminophenoxy)pyridine-2-carboxylate (PubChem CID 162090161) has the molecular formula C26H25N5O5 and a molecular weight of 487.52 g/mol. Its IUPAC name is 4-(4-aminophenoxy)-N-methylpyridine-2-carboxamide;methyl 4-(4-aminophenoxy)pyridine-2-carboxylate.
| Compound Name | 4-(4-aminophenoxy)-N-methylpyridine-2-carboxamide;methyl 4-(4-aminophenoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 162090161 |
| Molecular Formula | C26H25N5O5 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 4-(4-aminophenoxy)-N-methylpyridine-2-carboxamide;methyl 4-(4-aminophenoxy)pyridine-2-carboxylate |
| SMILES | CNC(=O)c1cc(Oc2ccc(N)cc2)ccn1.COC(=O)c1cc(Oc2ccc(N)cc2)ccn1 |
| InChI | InChI=1S/C13H13N3O2.C13H12N2O3/c1-15-13(17)12-8-11(6-7-16-12)18-10-4-2-9(14)3-5-10;1-17-13(16)12-8-11(6-7-15-12)18-10-4-2-9(14)3-5-10/h2-8H,14H2,1H3,(H,15,17);2-8H,14H2,1H3 |
| InChIKey | ZDMMQCDLUXOKPC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 151.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|