C26H30ClF3N4O7S — CID 162090679
(1,1,1-trifluoro-2-methylpropan-2-yl) 2-[(2S)-4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2-[2-methyl-2-(5-oxo-4H-1,2-oxazol-3-yl)propyl]-2,3-dihydro-1,4-benzoxazin-6-yl]acetate (PubChem CID 162090679) has the molecular formula C26H30ClF3N4O7S and a molecular weight of 635.06 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) 2-[(2S)-4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2-[2-methyl-2-(5-oxo-4H-1,2-oxazol-3-yl)propyl]-2,3-dihydro-1,4-benzoxazin-6-yl]acetate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) 2-[(2S)-4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2-[2-methyl-2-(5-oxo-4H-1,2-oxazol-3-yl)propyl]-2,3-dihydro-1,4-benzoxazin-6-yl]acetate |
|---|---|
| PubChem CID | 162090679 |
| Molecular Formula | C26H30ClF3N4O7S |
| Molecular Weight | 635.06 g/mol |
| Exact Mass | 634.15 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) 2-[(2S)-4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2-[2-methyl-2-(5-oxo-4H-1,2-oxazol-3-yl)propyl]-2,3-dihydro-1,4-benzoxazin-6-yl]acetate |
| SMILES | CCn1cc(S(=O)(=O)N2C[C@H](CC(C)(C)C3=NOC(=O)C3)Oc3ccc(CC(=O)OC(C)(C)C(F)(F)F)cc32)c(Cl)n1 |
| InChI | InChI=1S/C26H30ClF3N4O7S/c1-6-33-14-19(23(27)31-33)42(37,38)34-13-16(12-24(2,3)20-11-22(36)41-32-20)39-18-8-7-15(9-17(18)34)10-21(35)40-25(4,5)26(28,29)30/h7-9,14,16H,6,10-13H2,1-5H3/t16-/m0/s1 |
| InChIKey | ZDOHLMDEAHJUGT-INIZCTEOSA-N |
| XLogP | 4.66 |
| TPSA | 129.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.06 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|