C38H38N2O3 — CID 162091862
4-aminophenol;1-naphthalen-2-ylpropan-2-one;4-(1-naphthalen-2-ylpropan-2-ylamino)phenol (PubChem CID 162091862) has the molecular formula C38H38N2O3 and a molecular weight of 570.73 g/mol. Its IUPAC name is 4-aminophenol;1-naphthalen-2-ylpropan-2-one;4-(1-naphthalen-2-ylpropan-2-ylamino)phenol.
| Compound Name | 4-aminophenol;1-naphthalen-2-ylpropan-2-one;4-(1-naphthalen-2-ylpropan-2-ylamino)phenol |
|---|---|
| PubChem CID | 162091862 |
| Molecular Formula | C38H38N2O3 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | 4-aminophenol;1-naphthalen-2-ylpropan-2-one;4-(1-naphthalen-2-ylpropan-2-ylamino)phenol |
| SMILES | CC(=O)Cc1ccc2ccccc2c1.CC(Cc1ccc2ccccc2c1)Nc1ccc(O)cc1.Nc1ccc(O)cc1 |
| InChI | InChI=1S/C19H19NO.C13H12O.C6H7NO/c1-14(20-18-8-10-19(21)11-9-18)12-15-6-7-16-4-2-3-5-17(16)13-15;1-10(14)8-11-6-7-12-4-2-3-5-13(12)9-11;7-5-1-3-6(8)4-2-5/h2-11,13-14,20-21H,12H2,1H3;2-7,9H,8H2,1H3;1-4,8H,7H2 |
| InChIKey | ZDSLQSFDNXYGAS-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|