C30H42N2O7 — CID 162092077
2-(3,4-dimethoxyphenyl)-5-(2-methylpropyl)piperidin-4-ol;6-(3,4-dimethoxyphenyl)piperidine-2,4-dione (PubChem CID 162092077) has the molecular formula C30H42N2O7 and a molecular weight of 542.67 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-(2-methylpropyl)piperidin-4-ol;6-(3,4-dimethoxyphenyl)piperidine-2,4-dione.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-(2-methylpropyl)piperidin-4-ol;6-(3,4-dimethoxyphenyl)piperidine-2,4-dione |
|---|---|
| PubChem CID | 162092077 |
| Molecular Formula | C30H42N2O7 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-(2-methylpropyl)piperidin-4-ol;6-(3,4-dimethoxyphenyl)piperidine-2,4-dione |
| SMILES | COc1ccc(C2CC(=O)CC(=O)N2)cc1OC.COc1ccc(C2CC(O)C(CC(C)C)CN2)cc1OC |
| InChI | InChI=1S/C17H27NO3.C13H15NO4/c1-11(2)7-13-10-18-14(9-15(13)19)12-5-6-16(20-3)17(8-12)21-4;1-17-11-4-3-8(5-12(11)18-2)10-6-9(15)7-13(16)14-10/h5-6,8,11,13-15,18-19H,7,9-10H2,1-4H3;3-5,10H,6-7H2,1-2H3,(H,14,16) |
| InChIKey | ZDTFSMXNFCTRHK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|