About 2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde
2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde (PubChem CID 162092515) has the molecular formula C15H22N2O3
and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde |
| PubChem CID | 162092515 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde |
| SMILES | CC(C(=O)O)C1CCCN(C)C1.O=Cc1cccnc1 |
| InChI | InChI=1S/C9H17NO2.C6H5NO/c1-7(9(11)12)8-4-3-5-10(2)6-8;8-5-6-2-1-3-7-4-6/h7-8H,3-6H2,1-2H3,(H,11,12);1-5H |
| InChIKey | ZDUPROCIUHUJMJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde?
The IUPAC name of 2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde (CID 162092515) is 2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde.
What is the SMILES notation for 2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde?
The canonical SMILES for 2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde is CC(C(=O)O)C1CCCN(C)C1.O=Cc1cccnc1.
What is the InChIKey of 2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde?
The InChIKey is ZDUPROCIUHUJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C6H5NO/c1-7(9(11)12)8-4-3-5-10(2)6-8;8-5-6-2-1-3-7-4-6/h7-8H,3-6H2,1-2H3,(H,11,12);1-5H.
What are the key properties of 2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde?
2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde has a molecular weight of 278.35 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylpiperidin-3-yl)propanoic acid;pyridine-3-carbaldehyde is sourced from PubChem (CID 162092515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).