About butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol
butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol (PubChem CID 162092910) has the molecular formula C10H26N2O3
and a molecular weight of 222.33 g/mol. Its IUPAC name is butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol.
Molecular Properties
| Compound Name | butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol |
| PubChem CID | 162092910 |
| Molecular Formula | C10H26N2O3 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.19 |
| IUPAC Name | butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol |
| SMILES | CC(O)COC(C)CO.CCCCNN |
| InChI | InChI=1S/C6H14O3.C4H12N2/c1-5(8)4-9-6(2)3-7;1-2-3-4-6-5/h5-8H,3-4H2,1-2H3;6H,2-5H2,1H3 |
| InChIKey | ZDVWYXRBUYEVNG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol?
The IUPAC name of butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol (CID 162092910) is butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol.
What is the SMILES notation for butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol?
The canonical SMILES for butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol is CC(O)COC(C)CO.CCCCNN.
What is the InChIKey of butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol?
The InChIKey is ZDVWYXRBUYEVNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3.C4H12N2/c1-5(8)4-9-6(2)3-7;1-2-3-4-6-5/h5-8H,3-4H2,1-2H3;6H,2-5H2,1H3.
What are the key properties of butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol?
butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol has a molecular weight of 222.33 g/mol, XLogP of 0.01, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butylhydrazine;2-(2-hydroxypropoxy)propan-1-ol is sourced from PubChem (CID 162092910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).