C24H30O6 — CID 162093098
7'-(hydroxymethyl)-7-methoxy-4,4,4',4',5'-pentamethyl-2,2'-spirobi[3H-chromene]-6,6'-diol (PubChem CID 162093098) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is 7'-(hydroxymethyl)-7-methoxy-4,4,4',4',5'-pentamethyl-2,2'-spirobi[3H-chromene]-6,6'-diol.
| Compound Name | 7'-(hydroxymethyl)-7-methoxy-4,4,4',4',5'-pentamethyl-2,2'-spirobi[3H-chromene]-6,6'-diol |
|---|---|
| PubChem CID | 162093098 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 7'-(hydroxymethyl)-7-methoxy-4,4,4',4',5'-pentamethyl-2,2'-spirobi[3H-chromene]-6,6'-diol |
| SMILES | COc1cc2c(cc1O)C(C)(C)CC1(CC(C)(C)c3c(cc(CO)c(O)c3C)O1)O2 |
| InChI | InChI=1S/C24H30O6/c1-13-20-19(7-14(10-25)21(13)27)30-24(12-23(20,4)5)11-22(2,3)15-8-16(26)18(28-6)9-17(15)29-24/h7-9,25-27H,10-12H2,1-6H3 |
| InChIKey | MFPWYQQPGMGDDU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |