C20H33F4NO9 — CID 162093894
3-[3-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]butanenitrile (PubChem CID 162093894) has the molecular formula C20H33F4NO9 and a molecular weight of 507.47 g/mol. Its IUPAC name is 3-[3-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]butanenitrile.
| Compound Name | 3-[3-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]butanenitrile |
|---|---|
| PubChem CID | 162093894 |
| Molecular Formula | C20H33F4NO9 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 3-[3-[2-[[2-[1,1-difluoro-2-(2-hydroxy-3-prop-2-enoxypropoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]butanenitrile |
| SMILES | C=CCOCC(O)COCC(F)(F)OC(F)(F)COCOCCOCC(O)COC(C)CC#N |
| InChI | InChI=1S/C20H33F4NO9/c1-3-6-28-9-17(26)11-31-13-19(21,22)34-20(23,24)14-32-15-30-8-7-29-10-18(27)12-33-16(2)4-5-25/h3,16-18,26-27H,1,4,6-15H2,2H3 |
| InChIKey | ZDZFCCOHADYQHE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|