C39H47FO10 — CID 162094694
(6R,9S)-8-[[(2S,5R)-3-fluoro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 162094694) has the molecular formula C39H47FO10 and a molecular weight of 694.79 g/mol. Its IUPAC name is (6R,9S)-8-[[(2S,5R)-3-fluoro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (6R,9S)-8-[[(2S,5R)-3-fluoro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 162094694 |
| Molecular Formula | C39H47FO10 |
| Molecular Weight | 694.79 g/mol |
| Exact Mass | 694.32 |
| IUPAC Name | (6R,9S)-8-[[(2S,5R)-3-fluoro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC1(C)OC2C3OC(C)(C)O[C@H]3C(CO[C@H]3OC(COCc4ccccc4)[C@@H](OCc4ccccc4)C(OCc4ccccc4)C3F)O[C@@H]2O1 |
| InChI | InChI=1S/C39H47FO10/c1-38(2)47-32-29(46-37-35(34(32)48-38)49-39(3,4)50-37)24-44-36-30(40)33(43-22-27-18-12-7-13-19-27)31(42-21-26-16-10-6-11-17-26)28(45-36)23-41-20-25-14-8-5-9-15-25/h5-19,28-37H,20-24H2,1-4H3/t28?,29?,30?,31-,32+,33?,34?,35?,36+,37-/m1/s1 |
| InChIKey | ZEBXUFJYYXTHNU-ODTXKLIDSA-N |
| XLogP | 5.85 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.79 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |