C8H10F3N3O — CID 162098302
N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine (PubChem CID 162098302) has the molecular formula C8H10F3N3O and a molecular weight of 221.18 g/mol. Its IUPAC name is N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine.
| Compound Name | N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 162098302 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine |
| SMILES | CN(C)C=O.FC(F)(F)c1ncccn1 |
| InChI | InChI=1S/C5H3F3N2.C3H7NO/c6-5(7,8)4-9-2-1-3-10-4;1-4(2)3-5/h1-3H;3H,1-2H3 |
| InChIKey | ZENUIENJORWBKL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|