About N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine
N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine (PubChem CID 162098302) has the molecular formula C8H10F3N3O
and a molecular weight of 221.18 g/mol. Its IUPAC name is N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine |
| PubChem CID | 162098302 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine |
| SMILES | CN(C)C=O.FC(F)(F)c1ncccn1 |
| InChI | InChI=1S/C5H3F3N2.C3H7NO/c6-5(7,8)4-9-2-1-3-10-4;1-4(2)3-5/h1-3H;3H,1-2H3 |
| InChIKey | ZENUIENJORWBKL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine?
The IUPAC name of N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine (CID 162098302) is N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine.
What is the SMILES notation for N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine?
The canonical SMILES for N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine is CN(C)C=O.FC(F)(F)c1ncccn1.
What is the InChIKey of N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine?
The InChIKey is ZENUIENJORWBKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F3N2.C3H7NO/c6-5(7,8)4-9-2-1-3-10-4;1-4(2)3-5/h1-3H;3H,1-2H3.
What are the key properties of N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine?
N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine has a molecular weight of 221.18 g/mol, XLogP of 1.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;2-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 162098302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).