About CID 162098482
CID 162098482 (PubChem CID 162098482) has the molecular formula C29H23BF6N3O3
and a molecular weight of 586.32 g/mol.
Molecular Properties
| Compound Name | CID 162098482 |
| PubChem CID | 162098482 |
| Molecular Formula | C29H23BF6N3O3 |
| Molecular Weight | 586.32 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | — |
| SMILES | O=C[B]N1CCC(c2ccc(Cc3ncc(C(F)(F)F)c(C#Cc4cc(C(F)(F)F)ccc4CC(=O)O)n3)cc2)CC1 |
| InChI | InChI=1S/C29H23BF6N3O3/c31-28(32,33)23-7-5-22(15-27(41)42)21(14-23)6-8-25-24(29(34,35)36)16-37-26(38-25)13-18-1-3-19(4-2-18)20-9-11-39(12-10-20)30-17-40/h1-5,7,14,16-17,20H,9-13,15H2,(H,41,42) |
| InChIKey | BXORYIWLLYFSRQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.32 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 162098482 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162098482?
The IUPAC name of CID 162098482 (CID 162098482) is not available.
What is the SMILES notation for CID 162098482?
The canonical SMILES for CID 162098482 is O=C[B]N1CCC(c2ccc(Cc3ncc(C(F)(F)F)c(C#Cc4cc(C(F)(F)F)ccc4CC(=O)O)n3)cc2)CC1.
What is the InChIKey of CID 162098482?
The InChIKey is BXORYIWLLYFSRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H23BF6N3O3/c31-28(32,33)23-7-5-22(15-27(41)42)21(14-23)6-8-25-24(29(34,35)36)16-37-26(38-25)13-18-1-3-19(4-2-18)20-9-11-39(12-10-20)30-17-40/h1-5,7,14,16-17,20H,9-13,15H2,(H,41,42).
What are the key properties of CID 162098482?
CID 162098482 has a molecular weight of 586.32 g/mol, XLogP of 5.12, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162098482 is sourced from PubChem (CID 162098482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).