C31H42BN3O6 — CID 162098567
tert-butyl 6-[1-(1H-imidazole-2-carbonyl)azetidin-3-yl]oxy-2-methyl-3-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]benzoate (PubChem CID 162098567) has the molecular formula C31H42BN3O6 and a molecular weight of 563.50 g/mol. Its IUPAC name is tert-butyl 6-[1-(1H-imidazole-2-carbonyl)azetidin-3-yl]oxy-2-methyl-3-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]benzoate.
| Compound Name | tert-butyl 6-[1-(1H-imidazole-2-carbonyl)azetidin-3-yl]oxy-2-methyl-3-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 162098567 |
| Molecular Formula | C31H42BN3O6 |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 563.32 |
| IUPAC Name | tert-butyl 6-[1-(1H-imidazole-2-carbonyl)azetidin-3-yl]oxy-2-methyl-3-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]benzoate |
| SMILES | Cc1c(CCB2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)ccc(OC2CN(C(=O)c3ncc[nH]3)C2)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H42BN3O6/c1-18-19(10-11-32-40-24-15-20-14-23(30(20,5)6)31(24,7)41-32)8-9-22(25(18)28(37)39-29(2,3)4)38-21-16-35(17-21)27(36)26-33-12-13-34-26/h8-9,12-13,20-21,23-24H,10-11,14-17H2,1-7H3,(H,33,34)/t20-,23-,24+,31-/m0/s1 |
| InChIKey | ZEOORJLLZHMJPU-QJIGHKLCSA-N |
| XLogP | 4.85 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|