About 2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide
2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide (PubChem CID 162099179) has the molecular formula C16H15F3N4O
and a molecular weight of 336.32 g/mol. Its IUPAC name is 2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide |
| PubChem CID | 162099179 |
| Molecular Formula | C16H15F3N4O |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide |
| SMILES | Cc1nn(CC(N)=O)c(C)c1-c1cc(C(F)(F)F)cc2c1C=NC2 |
| InChI | InChI=1S/C16H15F3N4O/c1-8-15(9(2)23(22-8)7-14(20)24)12-4-11(16(17,18)19)3-10-5-21-6-13(10)12/h3-4,6H,5,7H2,1-2H3,(H2,20,24) |
| InChIKey | ZEQPGFRQSGAVPF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide?
The IUPAC name of 2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide (CID 162099179) is 2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide.
What is the SMILES notation for 2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide?
The canonical SMILES for 2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide is Cc1nn(CC(N)=O)c(C)c1-c1cc(C(F)(F)F)cc2c1C=NC2.
What is the InChIKey of 2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide?
The InChIKey is ZEQPGFRQSGAVPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F3N4O/c1-8-15(9(2)23(22-8)7-14(20)24)12-4-11(16(17,18)19)3-10-5-21-6-13(10)12/h3-4,6H,5,7H2,1-2H3,(H2,20,24).
What are the key properties of 2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide?
2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide has a molecular weight of 336.32 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dimethyl-4-[6-(trifluoromethyl)-1H-isoindol-4-yl]pyrazol-1-yl]acetamide is sourced from PubChem (CID 162099179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).