About 2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride
2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride (PubChem CID 162099557) has the molecular formula C20H30ClNO2
and a molecular weight of 351.92 g/mol. Its IUPAC name is 2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride.
Molecular Properties
| Compound Name | 2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride |
| PubChem CID | 162099557 |
| Molecular Formula | C20H30ClNO2 |
| Molecular Weight | 351.92 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride |
| SMILES | COc1c(C2CCCCC2)ccc(C(N)=O)c1C1CCCCC1.Cl |
| InChI | InChI=1S/C20H29NO2.ClH/c1-23-19-16(14-8-4-2-5-9-14)12-13-17(20(21)22)18(19)15-10-6-3-7-11-15;/h12-15H,2-11H2,1H3,(H2,21,22);1H |
| InChIKey | VPAOAVAKRVZZKW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.92 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride?
The IUPAC name of 2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride (CID 162099557) is 2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride.
What is the SMILES notation for 2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride?
The canonical SMILES for 2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride is COc1c(C2CCCCC2)ccc(C(N)=O)c1C1CCCCC1.Cl.
What is the InChIKey of 2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride?
The InChIKey is VPAOAVAKRVZZKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO2.ClH/c1-23-19-16(14-8-4-2-5-9-14)12-13-17(20(21)22)18(19)15-10-6-3-7-11-15;/h12-15H,2-11H2,1H3,(H2,21,22);1H.
What are the key properties of 2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride?
2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride has a molecular weight of 351.92 g/mol, XLogP of 5.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dicyclohexyl-3-methoxybenzamide;hydrochloride is sourced from PubChem (CID 162099557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).