C27H52N4O7 — CID 162100477
tert-butyl N-[[4-(hydrazinecarbonyl)cyclohexyl]methyl]carbamate;methane;4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 162100477) has the molecular formula C27H52N4O7 and a molecular weight of 544.73 g/mol. Its IUPAC name is tert-butyl N-[[4-(hydrazinecarbonyl)cyclohexyl]methyl]carbamate;methane;4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | tert-butyl N-[[4-(hydrazinecarbonyl)cyclohexyl]methyl]carbamate;methane;4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 162100477 |
| Molecular Formula | C27H52N4O7 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | tert-butyl N-[[4-(hydrazinecarbonyl)cyclohexyl]methyl]carbamate;methane;4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | C.CC(C)(C)OC(=O)NCC1CCC(C(=O)NN)CC1.CC(C)(C)OC(=O)NCC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C13H25N3O3.C13H23NO4.CH4/c1-13(2,3)19-12(18)15-8-9-4-6-10(7-5-9)11(17)16-14;1-13(2,3)18-12(17)14-8-9-4-6-10(7-5-9)11(15)16;/h9-10H,4-8,14H2,1-3H3,(H,15,18)(H,16,17);9-10H,4-8H2,1-3H3,(H,14,17)(H,15,16);1H4 |
| InChIKey | ZEUUDAOOFDSKBC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 169.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|