C39H41F3N7O6S+ — CID 162100565
[1-methyl-4-[[4-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]carbamoyl]phenyl]methyl]piperazin-1-ium-1-yl]methyl 2-phenylacetate;trifluoromethanesulfonic acid (PubChem CID 162100565) has the molecular formula C39H41F3N7O6S+ and a molecular weight of 792.86 g/mol. Its IUPAC name is [1-methyl-4-[[4-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]carbamoyl]phenyl]methyl]piperazin-1-ium-1-yl]methyl 2-phenylacetate;trifluoromethanesulfonic acid.
| Compound Name | [1-methyl-4-[[4-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]carbamoyl]phenyl]methyl]piperazin-1-ium-1-yl]methyl 2-phenylacetate;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 162100565 |
| Molecular Formula | C39H41F3N7O6S+ |
| Molecular Weight | 792.86 g/mol |
| Exact Mass | 792.28 |
| IUPAC Name | [1-methyl-4-[[4-[[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]carbamoyl]phenyl]methyl]piperazin-1-ium-1-yl]methyl 2-phenylacetate;trifluoromethanesulfonic acid |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CC[N+](C)(COC(=O)Cc4ccccc4)CC3)cc2)cc1Nc1nccc(-c2cccnc2)n1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C38H39N7O3.CHF3O3S/c1-28-10-15-33(24-35(28)43-38-40-18-16-34(42-38)32-9-6-17-39-25-32)41-37(47)31-13-11-30(12-14-31)26-44-19-21-45(2,22-20-44)27-48-36(46)23-29-7-4-3-5-8-29;2-1(3,4)8(5,6)7/h3-18,24-25H,19-23,26-27H2,1-2H3,(H-,40,41,42,43,47);(H,5,6,7)/p+1 |
| InChIKey | ZEVCHRSSKIKXKU-UHFFFAOYSA-O |
| XLogP | 6.24 |
| TPSA | 163.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.86 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|