C25H31N — CID 162101040
3-(2,2-dimethylpropyl)benzonitrile;1-(2,2-dimethylpropyl)-4-ethynylbenzene (PubChem CID 162101040) has the molecular formula C25H31N and a molecular weight of 345.53 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)benzonitrile;1-(2,2-dimethylpropyl)-4-ethynylbenzene.
| Compound Name | 3-(2,2-dimethylpropyl)benzonitrile;1-(2,2-dimethylpropyl)-4-ethynylbenzene |
|---|---|
| PubChem CID | 162101040 |
| Molecular Formula | C25H31N |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 3-(2,2-dimethylpropyl)benzonitrile;1-(2,2-dimethylpropyl)-4-ethynylbenzene |
| SMILES | C#Cc1ccc(CC(C)(C)C)cc1.CC(C)(C)Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C13H16.C12H15N/c1-5-11-6-8-12(9-7-11)10-13(2,3)4;1-12(2,3)8-10-5-4-6-11(7-10)9-13/h1,6-9H,10H2,2-4H3;4-7H,8H2,1-3H3 |
| InChIKey | ZEWQQHBATMDTFV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|