About 1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane
1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane (PubChem CID 162101226) has the molecular formula C24H31N3O
and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane.
Molecular Properties
| Compound Name | 1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane |
| PubChem CID | 162101226 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane |
| SMILES | C.CCN1CCN(Cc2nc(-c3ccc(OC)cc3)cc3ccccc23)CC1 |
| InChI | InChI=1S/C23H27N3O.CH4/c1-3-25-12-14-26(15-13-25)17-23-21-7-5-4-6-19(21)16-22(24-23)18-8-10-20(27-2)11-9-18;/h4-11,16H,3,12-15,17H2,1-2H3;1H4 |
| InChIKey | ZEXHLHNQMKMUKY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane?
The IUPAC name of 1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane (CID 162101226) is 1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane.
What is the SMILES notation for 1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane?
The canonical SMILES for 1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane is C.CCN1CCN(Cc2nc(-c3ccc(OC)cc3)cc3ccccc23)CC1.
What is the InChIKey of 1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane?
The InChIKey is ZEXHLHNQMKMUKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O.CH4/c1-3-25-12-14-26(15-13-25)17-23-21-7-5-4-6-19(21)16-22(24-23)18-8-10-20(27-2)11-9-18;/h4-11,16H,3,12-15,17H2,1-2H3;1H4.
What are the key properties of 1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane?
1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane has a molecular weight of 377.53 g/mol, XLogP of 4.68, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-ethylpiperazin-1-yl)methyl]-3-(4-methoxyphenyl)isoquinoline;methane is sourced from PubChem (CID 162101226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).