C20H36O2 — CID 162101368
2-tert-butylperoxy-2-methylpropane;1,2-dipropylbenzene (PubChem CID 162101368) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 2-tert-butylperoxy-2-methylpropane;1,2-dipropylbenzene.
| Compound Name | 2-tert-butylperoxy-2-methylpropane;1,2-dipropylbenzene |
|---|---|
| PubChem CID | 162101368 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 2-tert-butylperoxy-2-methylpropane;1,2-dipropylbenzene |
| SMILES | CC(C)(C)OOC(C)(C)C.CCCc1ccccc1CCC |
| InChI | InChI=1S/C12H18.C8H18O2/c1-3-7-11-9-5-6-10-12(11)8-4-2;1-7(2,3)9-10-8(4,5)6/h5-6,9-10H,3-4,7-8H2,1-2H3;1-6H3 |
| InChIKey | ZEXSZOGMPWJIRV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|