C23H24N6O4 — CID 162101947
5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[(Z)-5-(pyridin-3-ylamino)pent-2-enimidoyl]imidazolidine-2,4-dione (PubChem CID 162101947) has the molecular formula C23H24N6O4 and a molecular weight of 448.48 g/mol. Its IUPAC name is 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[(Z)-5-(pyridin-3-ylamino)pent-2-enimidoyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[(Z)-5-(pyridin-3-ylamino)pent-2-enimidoyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 162101947 |
| Molecular Formula | C23H24N6O4 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[(Z)-5-(pyridin-3-ylamino)pent-2-enimidoyl]imidazolidine-2,4-dione |
| SMILES | [H]/N=C(\C=C/CCNc1cccnc1)C1(CN2Cc3ccc(OC)cc3C2=O)NC(=O)NC1=O |
| InChI | InChI=1S/C23H24N6O4/c1-33-17-8-7-15-13-29(20(30)18(15)11-17)14-23(21(31)27-22(32)28-23)19(24)6-2-3-10-26-16-5-4-9-25-12-16/h2,4-9,11-12,24,26H,3,10,13-14H2,1H3,(H2,27,28,31,32)/b6-2-,24-19+ |
| InChIKey | ZEZUTCKEKMUHTA-NWMMHHQXSA-N |
| XLogP | 1.70 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|