About 4H-pyrido[1,2-a]pyrimidine;pyrimidine
4H-pyrido[1,2-a]pyrimidine;pyrimidine (PubChem CID 162102862) has the molecular formula C12H12N4
and a molecular weight of 212.26 g/mol. Its IUPAC name is 4H-pyrido[1,2-a]pyrimidine;pyrimidine.
Molecular Properties
| Compound Name | 4H-pyrido[1,2-a]pyrimidine;pyrimidine |
| PubChem CID | 162102862 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 4H-pyrido[1,2-a]pyrimidine;pyrimidine |
| SMILES | C1=CC2=NC=CCN2C=C1.c1cncnc1 |
| InChI | InChI=1S/C8H8N2.C4H4N2/c1-2-6-10-7-3-5-9-8(10)4-1;1-2-5-4-6-3-1/h1-6H,7H2;1-4H |
| InChIKey | ZFCSEILWJVPZEZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4H-pyrido[1,2-a]pyrimidine;pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrido[1,2-a]pyrimidine;pyrimidine?
The IUPAC name of 4H-pyrido[1,2-a]pyrimidine;pyrimidine (CID 162102862) is 4H-pyrido[1,2-a]pyrimidine;pyrimidine.
What is the SMILES notation for 4H-pyrido[1,2-a]pyrimidine;pyrimidine?
The canonical SMILES for 4H-pyrido[1,2-a]pyrimidine;pyrimidine is C1=CC2=NC=CCN2C=C1.c1cncnc1.
What is the InChIKey of 4H-pyrido[1,2-a]pyrimidine;pyrimidine?
The InChIKey is ZFCSEILWJVPZEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C4H4N2/c1-2-6-10-7-3-5-9-8(10)4-1;1-2-5-4-6-3-1/h1-6H,7H2;1-4H.
What are the key properties of 4H-pyrido[1,2-a]pyrimidine;pyrimidine?
4H-pyrido[1,2-a]pyrimidine;pyrimidine has a molecular weight of 212.26 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrido[1,2-a]pyrimidine;pyrimidine is sourced from PubChem (CID 162102862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).