C26H17Br5N2O4 — CID 162104301
3,4-dibromo-2-hydroxy-N-phenylbenzamide;3,4,5-tribromo-2-hydroxy-N-phenylbenzamide (PubChem CID 162104301) has the molecular formula C26H17Br5N2O4 and a molecular weight of 820.95 g/mol. Its IUPAC name is 3,4-dibromo-2-hydroxy-N-phenylbenzamide;3,4,5-tribromo-2-hydroxy-N-phenylbenzamide.
| Compound Name | 3,4-dibromo-2-hydroxy-N-phenylbenzamide;3,4,5-tribromo-2-hydroxy-N-phenylbenzamide |
|---|---|
| PubChem CID | 162104301 |
| Molecular Formula | C26H17Br5N2O4 |
| Molecular Weight | 820.95 g/mol |
| Exact Mass | 815.71 |
| IUPAC Name | 3,4-dibromo-2-hydroxy-N-phenylbenzamide;3,4,5-tribromo-2-hydroxy-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1cc(Br)c(Br)c(Br)c1O.O=C(Nc1ccccc1)c1ccc(Br)c(Br)c1O |
| InChI | InChI=1S/C13H8Br3NO2.C13H9Br2NO2/c14-9-6-8(12(18)11(16)10(9)15)13(19)17-7-4-2-1-3-5-7;14-10-7-6-9(12(17)11(10)15)13(18)16-8-4-2-1-3-5-8/h1-6,18H,(H,17,19);1-7,17H,(H,16,18) |
| InChIKey | ZFHJVWOJCNHPSC-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.95 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|