About methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate
methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate (PubChem CID 162105592) has the molecular formula C21H16BrF3N2O4
and a molecular weight of 497.27 g/mol. Its IUPAC name is methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate |
| PubChem CID | 162105592 |
| Molecular Formula | C21H16BrF3N2O4 |
| Molecular Weight | 497.27 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(-c2cccc(C(F)(F)F)c2)c1.COC(=O)c1ccnc(Br)c1 |
| InChI | InChI=1S/C14H10F3NO2.C7H6BrNO2/c1-20-13(19)10-5-6-18-12(8-10)9-3-2-4-11(7-9)14(15,16)17;1-11-7(10)5-2-3-9-6(8)4-5/h2-8H,1H3;2-4H,1H3 |
| InChIKey | ZFLRLVOMJZZFSU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.27 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate?
The IUPAC name of methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate (CID 162105592) is methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate.
What is the SMILES notation for methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate?
The canonical SMILES for methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate is COC(=O)c1ccnc(-c2cccc(C(F)(F)F)c2)c1.COC(=O)c1ccnc(Br)c1.
What is the InChIKey of methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate?
The InChIKey is ZFLRLVOMJZZFSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3NO2.C7H6BrNO2/c1-20-13(19)10-5-6-18-12(8-10)9-3-2-4-11(7-9)14(15,16)17;1-11-7(10)5-2-3-9-6(8)4-5/h2-8H,1H3;2-4H,1H3.
What are the key properties of methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate?
methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate has a molecular weight of 497.27 g/mol, XLogP of 5.18, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromopyridine-4-carboxylate;methyl 2-[3-(trifluoromethyl)phenyl]pyridine-4-carboxylate is sourced from PubChem (CID 162105592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).