C24H27FN4O4 — CID 162106350
acetic acid;9-(cyclobutylamino)-8-(2-fluoro-4-methylphenyl)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one (PubChem CID 162106350) has the molecular formula C24H27FN4O4 and a molecular weight of 454.50 g/mol. Its IUPAC name is acetic acid;9-(cyclobutylamino)-8-(2-fluoro-4-methylphenyl)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one.
| Compound Name | acetic acid;9-(cyclobutylamino)-8-(2-fluoro-4-methylphenyl)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 162106350 |
| Molecular Formula | C24H27FN4O4 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | acetic acid;9-(cyclobutylamino)-8-(2-fluoro-4-methylphenyl)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
| SMILES | CC(=O)O.Cc1ccc(-c2cc3c(cc2NC2CCC2)N2C(=NNC(=O)C2C)CO3)c(F)c1 |
| InChI | InChI=1S/C22H23FN4O2.C2H4O2/c1-12-6-7-15(17(23)8-12)16-9-20-19(10-18(16)24-14-4-3-5-14)27-13(2)22(28)26-25-21(27)11-29-20;1-2(3)4/h6-10,13-14,24H,3-5,11H2,1-2H3,(H,26,28);1H3,(H,3,4) |
| InChIKey | DLGYSDYUFNYVTL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|