C26H28F2N4O6S2 — CID 162107463
2-[(3S,4S)-3-[[5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]oxan-4-yl]isoindole-1,3-dione;sulfane (PubChem CID 162107463) has the molecular formula C26H28F2N4O6S2 and a molecular weight of 594.66 g/mol. Its IUPAC name is 2-[(3S,4S)-3-[[5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]oxan-4-yl]isoindole-1,3-dione;sulfane.
| Compound Name | 2-[(3S,4S)-3-[[5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]oxan-4-yl]isoindole-1,3-dione;sulfane |
|---|---|
| PubChem CID | 162107463 |
| Molecular Formula | C26H28F2N4O6S2 |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | 2-[(3S,4S)-3-[[5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]oxan-4-yl]isoindole-1,3-dione;sulfane |
| SMILES | COc1cc(OC)c(F)c(COc2cnc(N[C@@H]3COCC[C@@H]3N3C(=O)c4ccccc4C3=O)nc2)c1F.S.S |
| InChI | InChI=1S/C26H24F2N4O6.2H2S/c1-35-20-9-21(36-2)23(28)17(22(20)27)12-38-14-10-29-26(30-11-14)31-18-13-37-8-7-19(18)32-24(33)15-5-3-4-6-16(15)25(32)34;;/h3-6,9-11,18-19H,7-8,12-13H2,1-2H3,(H,29,30,31);2*1H2/t18-,19+;;/m1../s1 |
| InChIKey | ZFRRYJKWKQDCDY-QNCHGCKQSA-N |
| XLogP | 3.44 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|