C9H8F2N4O6S2 — CID 162107550
2-[(4,6-difluoro-1H-triazin-2-yl)amino]benzene-1,4-disulfonic acid (PubChem CID 162107550) has the molecular formula C9H8F2N4O6S2 and a molecular weight of 370.32 g/mol. Its IUPAC name is 2-[(4,6-difluoro-1H-triazin-2-yl)amino]benzene-1,4-disulfonic acid.
| Compound Name | 2-[(4,6-difluoro-1H-triazin-2-yl)amino]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 162107550 |
| Molecular Formula | C9H8F2N4O6S2 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 2-[(4,6-difluoro-1H-triazin-2-yl)amino]benzene-1,4-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(S(=O)(=O)O)c(NN2N=C(F)C=C(F)N2)c1 |
| InChI | InChI=1S/C9H8F2N4O6S2/c10-8-4-9(11)14-15(13-8)12-6-3-5(22(16,17)18)1-2-7(6)23(19,20)21/h1-4,12-13H,(H,16,17,18)(H,19,20,21) |
| InChIKey | WRMYZHOIARCDLD-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|