About tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine
tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine (PubChem CID 162107633) has the molecular formula C19H40N4O2
and a molecular weight of 356.56 g/mol. Its IUPAC name is tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine.
Molecular Properties
| Compound Name | tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine |
| PubChem CID | 162107633 |
| Molecular Formula | C19H40N4O2 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.32 |
| IUPAC Name | tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(C(=O)OC(C)(C)C)CC1.CC(C)N1CCNCC1 |
| InChI | InChI=1S/C12H24N2O2.C7H16N2/c1-10(2)13-6-8-14(9-7-13)11(15)16-12(3,4)5;1-7(2)9-5-3-8-4-6-9/h10H,6-9H2,1-5H3;7-8H,3-6H2,1-2H3 |
| InChIKey | ZFSJFCNHPHANOM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine?
The IUPAC name of tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine (CID 162107633) is tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine.
What is the SMILES notation for tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine?
The canonical SMILES for tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine is CC(C)N1CCN(C(=O)OC(C)(C)C)CC1.CC(C)N1CCNCC1.
What is the InChIKey of tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine?
The InChIKey is ZFSJFCNHPHANOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2.C7H16N2/c1-10(2)13-6-8-14(9-7-13)11(15)16-12(3,4)5;1-7(2)9-5-3-8-4-6-9/h10H,6-9H2,1-5H3;7-8H,3-6H2,1-2H3.
What are the key properties of tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine?
tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine has a molecular weight of 356.56 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-propan-2-ylpiperazine-1-carboxylate;1-propan-2-ylpiperazine is sourced from PubChem (CID 162107633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).