C29H31F3N4O3 — CID 162107672
2-[2-[(E)-2-[3-(2-morpholin-4-ylethyl)phenyl]ethenyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one;3,3,3-trifluoroprop-1-en-2-ol (PubChem CID 162107672) has the molecular formula C29H31F3N4O3 and a molecular weight of 540.59 g/mol. Its IUPAC name is 2-[2-[(E)-2-[3-(2-morpholin-4-ylethyl)phenyl]ethenyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one;3,3,3-trifluoroprop-1-en-2-ol.
| Compound Name | 2-[2-[(E)-2-[3-(2-morpholin-4-ylethyl)phenyl]ethenyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one;3,3,3-trifluoroprop-1-en-2-ol |
|---|---|
| PubChem CID | 162107672 |
| Molecular Formula | C29H31F3N4O3 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 2-[2-[(E)-2-[3-(2-morpholin-4-ylethyl)phenyl]ethenyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one;3,3,3-trifluoroprop-1-en-2-ol |
| SMILES | C=C(O)C(F)(F)F.O=C1NCCc2[nH]c(-c3ccnc(/C=C/c4cccc(CCN5CCOCC5)c4)c3)cc21 |
| InChI | InChI=1S/C26H28N4O2.C3H3F3O/c31-26-23-18-25(29-24(23)7-10-28-26)21-6-9-27-22(17-21)5-4-19-2-1-3-20(16-19)8-11-30-12-14-32-15-13-30;1-2(7)3(4,5)6/h1-6,9,16-18,29H,7-8,10-15H2,(H,28,31);7H,1H2/b5-4+; |
| InChIKey | ZFSMFBOIUCGVOA-FXRZFVDSSA-N |
| XLogP | 5.03 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|