About 2-methylpropane;piperidine-3-sulfonamide
2-methylpropane;piperidine-3-sulfonamide (PubChem CID 162108453) has the molecular formula C9H22N2O2S
and a molecular weight of 222.35 g/mol. Its IUPAC name is 2-methylpropane;piperidine-3-sulfonamide.
Molecular Properties
| Compound Name | 2-methylpropane;piperidine-3-sulfonamide |
| PubChem CID | 162108453 |
| Molecular Formula | C9H22N2O2S |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-methylpropane;piperidine-3-sulfonamide |
| SMILES | CC(C)C.NS(=O)(=O)C1CCCNC1 |
| InChI | InChI=1S/C5H12N2O2S.C4H10/c6-10(8,9)5-2-1-3-7-4-5;1-4(2)3/h5,7H,1-4H2,(H2,6,8,9);4H,1-3H3 |
| InChIKey | ZFUYXPJKDBWTJI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropane;piperidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;piperidine-3-sulfonamide?
The IUPAC name of 2-methylpropane;piperidine-3-sulfonamide (CID 162108453) is 2-methylpropane;piperidine-3-sulfonamide.
What is the SMILES notation for 2-methylpropane;piperidine-3-sulfonamide?
The canonical SMILES for 2-methylpropane;piperidine-3-sulfonamide is CC(C)C.NS(=O)(=O)C1CCCNC1.
What is the InChIKey of 2-methylpropane;piperidine-3-sulfonamide?
The InChIKey is ZFUYXPJKDBWTJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2S.C4H10/c6-10(8,9)5-2-1-3-7-4-5;1-4(2)3/h5,7H,1-4H2,(H2,6,8,9);4H,1-3H3.
What are the key properties of 2-methylpropane;piperidine-3-sulfonamide?
2-methylpropane;piperidine-3-sulfonamide has a molecular weight of 222.35 g/mol, XLogP of 0.69, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;piperidine-3-sulfonamide is sourced from PubChem (CID 162108453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).