About carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine
carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine (PubChem CID 162110505) has the molecular formula C10H11N3O3
and a molecular weight of 221.22 g/mol. Its IUPAC name is carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine.
Molecular Properties
| Compound Name | carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine |
| PubChem CID | 162110505 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine |
| SMILES | CCc1cc2c(N)noc2nc1C.O=C=O |
| InChI | InChI=1S/C9H11N3O.CO2/c1-3-6-4-7-8(10)12-13-9(7)11-5(6)2;2-1-3/h4H,3H2,1-2H3,(H2,10,12); |
| InChIKey | ZGBYLBNODKYYNB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine?
The IUPAC name of carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine (CID 162110505) is carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine.
What is the SMILES notation for carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine?
The canonical SMILES for carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine is CCc1cc2c(N)noc2nc1C.O=C=O.
What is the InChIKey of carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine?
The InChIKey is ZGBYLBNODKYYNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O.CO2/c1-3-6-4-7-8(10)12-13-9(7)11-5(6)2;2-1-3/h4H,3H2,1-2H3,(H2,10,12);.
What are the key properties of carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine?
carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine has a molecular weight of 221.22 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;5-ethyl-6-methyl-[1,2]oxazolo[5,4-b]pyridin-3-amine is sourced from PubChem (CID 162110505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).