C24H21ClF3N3O3 — CID 162111756
2-[5-(4-chloro-3-methylphenyl)-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1-(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)ethanone (PubChem CID 162111756) has the molecular formula C24H21ClF3N3O3 and a molecular weight of 491.90 g/mol. Its IUPAC name is 2-[5-(4-chloro-3-methylphenyl)-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1-(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)ethanone.
| Compound Name | 2-[5-(4-chloro-3-methylphenyl)-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1-(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)ethanone |
|---|---|
| PubChem CID | 162111756 |
| Molecular Formula | C24H21ClF3N3O3 |
| Molecular Weight | 491.90 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 2-[5-(4-chloro-3-methylphenyl)-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-1-(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)ethanone |
| SMILES | Cc1cc(-c2cc(CC(=O)c3cnc4c(c3)OCCN4C)cnc2OCC(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C24H21ClF3N3O3/c1-14-7-16(3-4-19(14)25)18-8-15(11-30-23(18)34-13-24(26,27)28)9-20(32)17-10-21-22(29-12-17)31(2)5-6-33-21/h3-4,7-8,10-12H,5-6,9,13H2,1-2H3 |
| InChIKey | ZGFYICUECYCJGD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.90 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |