C24H29F6IO6S3 — CID 162111776
bis(4-tert-butylphenyl)iodanium;trifluoro-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylmethane (PubChem CID 162111776) has the molecular formula C24H29F6IO6S3 and a molecular weight of 750.58 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)iodanium;trifluoro-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylmethane.
| Compound Name | bis(4-tert-butylphenyl)iodanium;trifluoro-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylmethane |
|---|---|
| PubChem CID | 162111776 |
| Molecular Formula | C24H29F6IO6S3 |
| Molecular Weight | 750.58 g/mol |
| Exact Mass | 750.01 |
| IUPAC Name | bis(4-tert-butylphenyl)iodanium;trifluoro-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylmethane |
| SMILES | CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.CS(=O)(=O)[C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H26I.C4H3F6O6S3/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;1-17(11,12)2(18(13,14)3(5,6)7)19(15,16)4(8,9)10/h7-14H,1-6H3;1H3/q+1;-1 |
| InChIKey | ZGGAPQOJHDJXSY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|