C23H21Cl2N7O2 — CID 162111819
6-[[1-[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]piperidin-3-yl]methyl]-3-nitropyridin-2-amine (PubChem CID 162111819) has the molecular formula C23H21Cl2N7O2 and a molecular weight of 498.37 g/mol. Its IUPAC name is 6-[[1-[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]piperidin-3-yl]methyl]-3-nitropyridin-2-amine.
| Compound Name | 6-[[1-[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]piperidin-3-yl]methyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 162111819 |
| Molecular Formula | C23H21Cl2N7O2 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 6-[[1-[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]piperidin-3-yl]methyl]-3-nitropyridin-2-amine |
| SMILES | Nc1nc(CC2CCCN(c3nc(-c4ccc(Cl)cc4Cl)cc4nccn34)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H21Cl2N7O2/c24-15-3-5-17(18(25)11-15)19-12-21-27-7-9-31(21)23(29-19)30-8-1-2-14(13-30)10-16-4-6-20(32(33)34)22(26)28-16/h3-7,9,11-12,14H,1-2,8,10,13H2,(H2,26,28) |
| InChIKey | ZGGFGTLXAIRYPF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|