C15H23N3O4S — CID 162112445
tert-butyl (3S)-3-(4-nitroanilino)pyrrolidine-1-carboxylate;sulfane (PubChem CID 162112445) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is tert-butyl (3S)-3-(4-nitroanilino)pyrrolidine-1-carboxylate;sulfane.
| Compound Name | tert-butyl (3S)-3-(4-nitroanilino)pyrrolidine-1-carboxylate;sulfane |
|---|---|
| PubChem CID | 162112445 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | tert-butyl (3S)-3-(4-nitroanilino)pyrrolidine-1-carboxylate;sulfane |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](Nc2ccc([N+](=O)[O-])cc2)C1.S |
| InChI | InChI=1S/C15H21N3O4.H2S/c1-15(2,3)22-14(19)17-9-8-12(10-17)16-11-4-6-13(7-5-11)18(20)21;/h4-7,12,16H,8-10H2,1-3H3;1H2/t12-;/m0./s1 |
| InChIKey | ZGICJYIYQJCHKU-YDALLXLXSA-N |
| XLogP | 3.13 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|