About carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium
carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium (PubChem CID 162113705) has the molecular formula C16H30NO2Y-
and a molecular weight of 357.33 g/mol. Its IUPAC name is carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium.
Molecular Properties
| Compound Name | carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium |
| PubChem CID | 162113705 |
| Molecular Formula | C16H30NO2Y- |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium |
| SMILES | C[C@@H](CC1CCCCC1)OC(=O)[C@@H]1CCCN1C.[CH3-].[Y] |
| InChI | InChI=1S/C15H27NO2.CH3.Y/c1-12(11-13-7-4-3-5-8-13)18-15(17)14-9-6-10-16(14)2;;/h12-14H,3-11H2,1-2H3;1H3;/q;-1;/t12-,14-;;/m0../s1 |
| InChIKey | KVOKETSIANFTNN-FORAGAHYSA-N |
| XLogP | 3.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium?
The IUPAC name of carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium (CID 162113705) is carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium.
What is the SMILES notation for carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium?
The canonical SMILES for carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium is C[C@@H](CC1CCCCC1)OC(=O)[C@@H]1CCCN1C.[CH3-].[Y].
What is the InChIKey of carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium?
The InChIKey is KVOKETSIANFTNN-FORAGAHYSA-N. The full InChI is InChI=1S/C15H27NO2.CH3.Y/c1-12(11-13-7-4-3-5-8-13)18-15(17)14-9-6-10-16(14)2;;/h12-14H,3-11H2,1-2H3;1H3;/q;-1;/t12-,14-;;/m0../s1.
What are the key properties of carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium?
carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium has a molecular weight of 357.33 g/mol, XLogP of 3.43, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;[(2S)-1-cyclohexylpropan-2-yl] (2S)-1-methylpyrrolidine-2-carboxylate;yttrium is sourced from PubChem (CID 162113705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).