About 3-chloro-2-ethylbenzonitrile;propane;toluene
3-chloro-2-ethylbenzonitrile;propane;toluene (PubChem CID 162114845) has the molecular formula C19H24ClN
and a molecular weight of 301.86 g/mol. Its IUPAC name is 3-chloro-2-ethylbenzonitrile;propane;toluene.
Molecular Properties
| Compound Name | 3-chloro-2-ethylbenzonitrile;propane;toluene |
| PubChem CID | 162114845 |
| Molecular Formula | C19H24ClN |
| Molecular Weight | 301.86 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 3-chloro-2-ethylbenzonitrile;propane;toluene |
| SMILES | CCC.CCc1c(Cl)cccc1C#N.Cc1ccccc1 |
| InChI | InChI=1S/C9H8ClN.C7H8.C3H8/c1-2-8-7(6-11)4-3-5-9(8)10;1-7-5-3-2-4-6-7;1-3-2/h3-5H,2H2,1H3;2-6H,1H3;3H2,1-2H3 |
| InChIKey | ZGPZMRZTCWNZJA-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.86 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-2-ethylbenzonitrile;propane;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-ethylbenzonitrile;propane;toluene?
The IUPAC name of 3-chloro-2-ethylbenzonitrile;propane;toluene (CID 162114845) is 3-chloro-2-ethylbenzonitrile;propane;toluene.
What is the SMILES notation for 3-chloro-2-ethylbenzonitrile;propane;toluene?
The canonical SMILES for 3-chloro-2-ethylbenzonitrile;propane;toluene is CCC.CCc1c(Cl)cccc1C#N.Cc1ccccc1.
What is the InChIKey of 3-chloro-2-ethylbenzonitrile;propane;toluene?
The InChIKey is ZGPZMRZTCWNZJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN.C7H8.C3H8/c1-2-8-7(6-11)4-3-5-9(8)10;1-7-5-3-2-4-6-7;1-3-2/h3-5H,2H2,1H3;2-6H,1H3;3H2,1-2H3.
What are the key properties of 3-chloro-2-ethylbenzonitrile;propane;toluene?
3-chloro-2-ethylbenzonitrile;propane;toluene has a molecular weight of 301.86 g/mol, XLogP of 6.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-ethylbenzonitrile;propane;toluene is sourced from PubChem (CID 162114845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).