C25H37ClN2O — CID 162116795
1-(4-aminocyclohexyl)-4-[1-(cyclohexylmethyl)indol-3-yl]butan-2-one;hydrochloride (PubChem CID 162116795) has the molecular formula C25H37ClN2O and a molecular weight of 417.04 g/mol. Its IUPAC name is 1-(4-aminocyclohexyl)-4-[1-(cyclohexylmethyl)indol-3-yl]butan-2-one;hydrochloride.
| Compound Name | 1-(4-aminocyclohexyl)-4-[1-(cyclohexylmethyl)indol-3-yl]butan-2-one;hydrochloride |
|---|---|
| PubChem CID | 162116795 |
| Molecular Formula | C25H37ClN2O |
| Molecular Weight | 417.04 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 1-(4-aminocyclohexyl)-4-[1-(cyclohexylmethyl)indol-3-yl]butan-2-one;hydrochloride |
| SMILES | Cl.NC1CCC(CC(=O)CCc2cn(CC3CCCCC3)c3ccccc23)CC1 |
| InChI | InChI=1S/C25H36N2O.ClH/c26-22-13-10-19(11-14-22)16-23(28)15-12-21-18-27(17-20-6-2-1-3-7-20)25-9-5-4-8-24(21)25;/h4-5,8-9,18-20,22H,1-3,6-7,10-17,26H2;1H |
| InChIKey | NOXHOKPQVJLJEP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.04 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |