C26H35N3O3 — CID 162117435
3-[4-(1-acetylpiperidin-4-yl)oxyphenyl]-2-methylquinazolin-4-one;ethane (PubChem CID 162117435) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 3-[4-(1-acetylpiperidin-4-yl)oxyphenyl]-2-methylquinazolin-4-one;ethane.
| Compound Name | 3-[4-(1-acetylpiperidin-4-yl)oxyphenyl]-2-methylquinazolin-4-one;ethane |
|---|---|
| PubChem CID | 162117435 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 3-[4-(1-acetylpiperidin-4-yl)oxyphenyl]-2-methylquinazolin-4-one;ethane |
| SMILES | CC.CC.CC(=O)N1CCC(Oc2ccc(-n3c(C)nc4ccccc4c3=O)cc2)CC1 |
| InChI | InChI=1S/C22H23N3O3.2C2H6/c1-15-23-21-6-4-3-5-20(21)22(27)25(15)17-7-9-18(10-8-17)28-19-11-13-24(14-12-19)16(2)26;2*1-2/h3-10,19H,11-14H2,1-2H3;2*1-2H3 |
| InChIKey | ZGYMGKYDGJTFMN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |