C14H20N2O4S — CID 162117458
methyl 2-[2-(cyclobutylsulfonylmethyl)pyrimidin-4-yl]-2-methylpropanoate (PubChem CID 162117458) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is methyl 2-[2-(cyclobutylsulfonylmethyl)pyrimidin-4-yl]-2-methylpropanoate.
| Compound Name | methyl 2-[2-(cyclobutylsulfonylmethyl)pyrimidin-4-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 162117458 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | methyl 2-[2-(cyclobutylsulfonylmethyl)pyrimidin-4-yl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)c1ccnc(CS(=O)(=O)C2CCC2)n1 |
| InChI | InChI=1S/C14H20N2O4S/c1-14(2,13(17)20-3)11-7-8-15-12(16-11)9-21(18,19)10-5-4-6-10/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | ZGYNRXQTLIARTD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |