C24H36N2O4 — CID 162118134
3-cyclohexyl-3-[[(3R,6R)-6-(1-cyclohexyl-2-isocyanoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]propanenitrile (PubChem CID 162118134) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is 3-cyclohexyl-3-[[(3R,6R)-6-(1-cyclohexyl-2-isocyanoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]propanenitrile.
| Compound Name | 3-cyclohexyl-3-[[(3R,6R)-6-(1-cyclohexyl-2-isocyanoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]propanenitrile |
|---|---|
| PubChem CID | 162118134 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 3-cyclohexyl-3-[[(3R,6R)-6-(1-cyclohexyl-2-isocyanoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]propanenitrile |
| SMILES | [C-]#[N+]CC(O[C@@H]1COC2C1OC[C@H]2OC(CC#N)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H36N2O4/c1-26-14-20(18-10-6-3-7-11-18)30-22-16-28-23-21(15-27-24(22)23)29-19(12-13-25)17-8-4-2-5-9-17/h17-24H,2-12,14-16H2/t19?,20?,21-,22-,23?,24?/m1/s1 |
| InChIKey | ZHAUISDOSNEPES-WCJAIXNRSA-N |
| XLogP | 4.29 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|