About 3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine
3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine (PubChem CID 162118640) has the molecular formula C15H14BrNO
and a molecular weight of 304.19 g/mol. Its IUPAC name is 3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine.
Molecular Properties
| Compound Name | 3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine |
| PubChem CID | 162118640 |
| Molecular Formula | C15H14BrNO |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine |
| SMILES | C#CCOc1ccc(C2=CCC(Br)C(=C)N2)cc1 |
| InChI | InChI=1S/C15H14BrNO/c1-3-10-18-13-6-4-12(5-7-13)15-9-8-14(16)11(2)17-15/h1,4-7,9,14,17H,2,8,10H2 |
| InChIKey | DSYVCUJZFINMLE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine?
The IUPAC name of 3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine (CID 162118640) is 3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine.
What is the SMILES notation for 3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine?
The canonical SMILES for 3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine is C#CCOc1ccc(C2=CCC(Br)C(=C)N2)cc1.
What is the InChIKey of 3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine?
The InChIKey is DSYVCUJZFINMLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrNO/c1-3-10-18-13-6-4-12(5-7-13)15-9-8-14(16)11(2)17-15/h1,4-7,9,14,17H,2,8,10H2.
What are the key properties of 3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine?
3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine has a molecular weight of 304.19 g/mol, XLogP of 3.31, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-methylidene-6-(4-prop-2-ynoxyphenyl)-3,4-dihydro-1H-pyridine is sourced from PubChem (CID 162118640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).