About N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile
N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile (PubChem CID 162118719) has the molecular formula C5H9N3O4
and a molecular weight of 175.14 g/mol. Its IUPAC name is N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile.
Molecular Properties
| Compound Name | N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile |
| PubChem CID | 162118719 |
| Molecular Formula | C5H9N3O4 |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile |
| SMILES | N#CCO.NC(=O)NC(=O)CO |
| InChI | InChI=1S/C3H6N2O3.C2H3NO/c4-3(8)5-2(7)1-6;3-1-2-4/h6H,1H2,(H3,4,5,7,8);4H,2H2 |
| InChIKey | ZHCSLJMBECYHFD-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 136.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|
Analyze N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile?
The IUPAC name of N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile (CID 162118719) is N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile.
What is the SMILES notation for N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile?
The canonical SMILES for N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile is N#CCO.NC(=O)NC(=O)CO.
What is the InChIKey of N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile?
The InChIKey is ZHCSLJMBECYHFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O3.C2H3NO/c4-3(8)5-2(7)1-6;3-1-2-4/h6H,1H2,(H3,4,5,7,8);4H,2H2.
What are the key properties of N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile?
N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile has a molecular weight of 175.14 g/mol, XLogP of -2.32, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamoyl-2-hydroxyacetamide;2-hydroxyacetonitrile is sourced from PubChem (CID 162118719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).