C24H31N5O3 — CID 162119231
N-[4-[1-(4-propan-2-yl-1,3-oxazole-5-carbonyl)piperidin-4-yl]butyl]-2H-pyrrolo[3,2-c]pyridine-2-carboxamide (PubChem CID 162119231) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[4-[1-(4-propan-2-yl-1,3-oxazole-5-carbonyl)piperidin-4-yl]butyl]-2H-pyrrolo[3,2-c]pyridine-2-carboxamide.
| Compound Name | N-[4-[1-(4-propan-2-yl-1,3-oxazole-5-carbonyl)piperidin-4-yl]butyl]-2H-pyrrolo[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162119231 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | N-[4-[1-(4-propan-2-yl-1,3-oxazole-5-carbonyl)piperidin-4-yl]butyl]-2H-pyrrolo[3,2-c]pyridine-2-carboxamide |
| SMILES | CC(C)c1ncoc1C(=O)N1CCC(CCCCNC(=O)C2C=c3cnccc3=N2)CC1 |
| InChI | InChI=1S/C24H31N5O3/c1-16(2)21-22(32-15-27-21)24(31)29-11-7-17(8-12-29)5-3-4-9-26-23(30)20-13-18-14-25-10-6-19(18)28-20/h6,10,13-17,20H,3-5,7-9,11-12H2,1-2H3,(H,26,30) |
| InChIKey | ZHENGBPHJUQIMF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|